![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[DIR]](/icons/folder.gif) | 1army/ | 02-Dec-2008 04:45 | - |
| 1august2005toronto/ | 28-Nov-2008 07:58 | - |
| 1banners/ | 28-Nov-2008 07:59 | - |
| 2animated/ | 24-Oct-2008 21:49 | - |
| 2canada/ | 24-Oct-2008 21:49 | - |
| 2police/ | 02-Dec-2008 04:54 | - |
| 3laos/ | 02-Dec-2008 05:04 | - |
| 4canada/ | 24-Oct-2008 21:49 | - |
| 420woreason/ | 24-Oct-2008 21:49 | - |
![[TXT]](/icons/text.gif) | 1999 flyers, banners, posters, handbills. MMM and more..htm | 04-Apr-2008 05:55 | 23K |
| 2000 flyers, banners, posters, handbills. MMM and more.htm | 04-Apr-2008 05:57 | 33K |
| 2000seattle-mmm-march/ | 24-Oct-2008 21:49 | - |
| 2000seattle-mmm-premarch/ | 24-Oct-2008 21:49 | - |
| 2001 cannabis events_files/ | 14-Jul-2008 16:18 | - |
| 2001 flyers, banners, posters, handbills. MMM and more.htm | 04-Apr-2008 05:51 | 31K |
| 2002 flyers, banners, posters, handbills. MMM and more.htm | 04-Apr-2008 06:02 | 47K |
| 2003 flyers, banners, posters, handbills, etc.. MMM and more.htm | 03-Apr-2008 03:59 | 47K |
| 2004 flyers, banners, posters, handbills. MMM and more. Page 1.htm | 01-Apr-2008 22:54 | 66K |
| 2004 flyers, banners, posters, handbills. MMM and more. Page 2.htm | 28-Oct-2008 23:14 | 38K |
| 2004 flyers, banners, posters, handbills. MMM and more. Page 3.htm | 28-Oct-2008 23:00 | 38K |
| 2004 flyers, banners, posters, handbills. MMM and more. Page 4.htm | 28-Oct-2008 23:00 | 17K |
| 2005-emery/ | 28-Nov-2008 08:02 | - |
| 2005 cannabis-friendly events. Not the focus, though.htm | 27-Oct-2008 08:21 | 13K |
| 2005 cannabis events. Posters, flyers, banners, video ads, etc.. Page 1.htm | 25-Oct-2008 11:21 | 55K |
| 2005 cannabis events. Posters, flyers, banners, video ads, etc.. Page 2.htm | 27-Oct-2008 08:14 | 40K |
| 2005 cannabis events. Posters, flyers, banners, video ads, etc.. Page 3.htm | 27-Oct-2008 08:15 | 39K |
| 2005 cannabis events. Posters, flyers, banners, video ads, etc.. Page 4.htm | 27-Oct-2008 09:07 | 41K |
| 2005 cannabis events. Posters, flyers, banners, video ads, etc.. Page 5.htm | 27-Oct-2008 09:07 | 16K |
| 2005 favorites. Cannabis event images.htm | 01-Apr-2008 19:20 | 44K |
| 2005favorites/ | 29-Mar-2009 23:13 | - |
| 2005gmm/ | 15-Mar-2009 07:19 | - |
| 2005july29vancouver/ | 24-Oct-2008 21:49 | - |
| 2005mj/ | 29-Mar-2009 23:53 | - |
| 2006/ | 21-Mar-2009 10:06 | - |
| 2006 GMM-MMM flyers, banners. Not individual cities.htm | 01-Apr-2008 18:53 | 23K |
| 2006flyers/ | 21-Mar-2009 11:28 | - |
| 2006gmm/ | 28-Mar-2009 20:23 | - |
| 2007/ | 15-Mar-2009 07:42 | - |
| 2007allgraphics/ | 15-Mar-2009 07:48 | - |
| 2007flyers/ | 15-Mar-2009 07:54 | - |
| 2007gmmflyers/ | 15-Mar-2009 07:58 | - |
| 2007graphics/ | 15-Mar-2009 08:07 | - |
| 2008/ | 26-Apr-2009 05:53 | - |
| 2008gmmflyers/ | 26-Apr-2009 05:47 | - |
| 2008graphics/ | 26-Apr-2009 05:16 | - |
| Activist-Jon-Fulford-shows-off-100-Plants-COOOL-!!/ | 24-Oct-2008 21:49 | - |
| Amsterdam, Netherlands_ June 4, 2005_ Legalize it street rav.htm | 19-May-2006 00:17 | 16K |
| Amsterdam, Netherlands_ June 5, 2004_ Legalize it street rav.htm | 20-May-2006 07:49 | 22K |
| Amsterdam, Netherlands_ May 7, 2005 event_ MMM joined up wit.htm | 19-May-2006 00:53 | 38K |
| Anti-DrugWar-Vigil/ | 24-Oct-2008 21:49 | - |
| Auckland, New Zealand. 1999 MMM.htm | 25-Oct-2008 05:08 | 15K |
| Auckland, New Zealand. 2000 MMM.htm | 25-Oct-2008 05:39 | 20K |
| Auckland, New Zealand. GMM-MMM 2006.htm | 11-Nov-2007 15:00 | 31K |
| Belgrade, Serbia. GMM-MMM 2005.htm | 03-Nov-2007 05:21 | 23K |
| Berlin, Germany. 2007 GMM-MMM. Posters, flyers, banners.htm | 25-Oct-2008 09:10 | 15K |
| Bobs-glass/ | 24-Oct-2008 21:49 | - |
| Boulder, Colorado, USA. 420 events. April 20, 2006.htm | 30-Apr-2008 09:32 | 31K |
| Boulder, Colorado, USA. Global Marijuana March. May 3, 2008.htm | 06-May-2008 15:49 | 26K |
| Boulder, Colorado, USA. Global Marijuana March. May 5, 2007.htm | 25-Oct-2008 09:58 | 16K |
| Bremen, Germany. 2002 MMM.htm | 11-Nov-2007 15:55 | 64K |
| Budapest, Hungary_ GMM-MMM 2006.htm | 16-May-2006 20:39 | 13K |
| Buenos Aires, Argentina. 2005 MMM.htm | 11-Nov-2007 15:20 | 60K |
| Calgary, Alberta, Canada_ GMM-MMM 2006.htm | 17-Feb-2007 13:08 | 58K |
| Campaigns, charts_ Cannabis, drug reform, prison brutality,_.htm | 08-Apr-2006 16:58 | 43K |
| Canada poll on marijuana. June 2007 by Angus Reid.htm | 14-Jul-2007 07:33 | 18K |
| Canada poll on marijuana_ November 2004 by SES.htm | 14-Jul-2007 07:31 | 24K |
| Canadian campaigns_ Renee Boje, Marc Emery, etc_.htm | 15-Apr-2008 22:43 | 29K |
| Canadian sovereignty_ Not a U_S_ doormat.htm | 21-Dec-2005 03:17 | 26K |
| Cannabis events worldwide. By year..htm | 01-Apr-2008 17:27 | 64K |
| Cape-Town-2005-MMM/ | 12-Oct-2008 05:10 | - |
| Cape Town, South Africa_ 7 May 2005 MMM_ Global Million Mari.htm | 04-Jan-2006 22:06 | 43K |
| Charts and stats. Drug war and more.htm | 09-Oct-2008 02:24 | 81K |
| Charts and stats. Drug war and more_files/ | 14-Jul-2008 16:18 | - |
| Cities, states, nations. Cannabis activities.htm | 15-Apr-2008 22:35 | 19K |
| City folder 5.htm | 23-Oct-2007 16:03 | 11K |
| Coffeeshops-Enschede/ | 12-Oct-2008 05:10 | - |
| Cryote's folder.htm | 15-Apr-2008 22:48 | 59K |
| Dallas, Texas, USA_ GMM-MMM 2006.htm | 14-May-2006 21:43 | 31K |
| Darwin, Australia_ GMM-MMM 2006.htm | 14-May-2006 21:45 | 16K |
| Des Moines, Iowa, USA. GMM-MMM 2006.htm | 11-Nov-2007 15:48 | 48K |
| Dogs-1st-Album/ | 12-Oct-2008 05:11 | - |
| ENCOD_General_Assembly_in_Berlin__25_and_26_June_2005/ | 12-Oct-2008 05:11 | - |
| Edmonton, Alberta, Canada. Operation Overgrow 2006.htm | 11-Nov-2007 15:51 | 25K |
| Europe polls. Marijuana and more. 2006.htm | 14-Jul-2007 06:06 | 18K |
| Finland. 2007 GMM-MMM. Posters, flyers, banners.htm | 21-Apr-2007 08:56 | 32K |
| Flyers, banners, t-shirts, rally posters, satire, etc_.htm | 13-Jan-2006 11:32 | 68K |
| Free-Marc-Emery-and-all-Cannabis-prisoners/ | 12-Oct-2008 05:11 | - |
| Free-Mary-Emery-Demo-16-Septembre-2005-@-Canadian-Embassy-Berlin/ | 12-Oct-2008 05:11 | - |
| GENDRECK-WEG-Feldbefreiungs-Camp-2007/ | 12-Oct-2008 05:11 | - |
| GMM-MMM banners, flyers, posters, handbills, backgrounds.htm | 15-Apr-2008 22:01 | 63K |
| Graphics for posters, banners, flyers.htm | 15-Apr-2008 22:25 | 39K |
| Hamilton, Ontario, Canada. 420 event. April 20, 2006.htm | 11-Nov-2007 15:43 | 61K |
| Hanfparade-2006/ | 12-Oct-2008 05:11 | - |
| Hanfparade-2007/ | 12-Oct-2008 05:11 | - |
| Hartford, Connecticut, USA_ GMM-MMM 2006.htm | 19-May-2006 22:16 | 22K |
| HighlifeDemo2006/ | 12-Oct-2008 05:11 | - |
| Iowa City, Iowa, USA. GMM-MMM 2006.htm | 11-Nov-2007 15:49 | 43K |
| Japan. 2007 GMM-MMM. Posters, flyers, banners..htm | 25-Apr-2007 10:31 | 18K |
| Jerusalem, Israel. 2006 GMM-MMM.htm | 11-Nov-2007 15:14 | 24K |
| Jerusalem, Israel. 2007 Global Marijuana March.htm | 25-Oct-2008 09:59 | 21K |
| Kiev, Ukraine_ GMM-MMM 2006.htm | 14-May-2006 21:49 | 36K |
| Madrid, Spain. 2005 MMM.htm | 17-Mar-2007 02:43 | 62K |
| Madrid, Spain. May 8, 2004. Million Joint March.htm | 17-Mar-2007 22:30 | 27K |
| Manley Hot Springs, Alaska, USA. 2007 Global Marijuana March.htm | 25-Oct-2008 10:00 | 10K |
| Manley Hot Springs, Alaska, USA_ GMM-MMM 2006.htm | 14-May-2006 21:51 | 22K |
| Marc Scott Emery. Free Canada's Prince of Pot! Page 1.htm | 25-Jan-2008 00:21 | 119K |
| Marc Scott Emery. Free Canada's Prince of Pot! Page 2.htm | 25-Oct-2008 07:00 | 40K |
| Marc Scott Emery. Free Canada's Prince of Pot! Page 3.htm | 26-Oct-2008 08:14 | 37K |
| Marc Scott Emery_ Free Canada's Prince of Pot!.htm | 24-Jan-2008 19:21 | 119K |
![[ ]](/icons/compressed.gif) | Marihemp CSS files. Navigation and framing images.zip | 25-Oct-2008 02:51 | 6.8K |
| Marijuana arrests. Many charts. NORML USA.htm | 22-Nov-2007 02:36 | 36K |
| Mexico City, Mexico. GMM-MMM 2006.htm | 06-Mar-2007 14:27 | 49K |
| Montevideo, Uruguay. 2007 GMM-MMM. Posters, flyers, banners.htm | 25-Oct-2008 10:01 | 12K |
| Montevideo, Uruguay. May 5, 2007 Global Marijuana March..htm | 22-Sep-2007 13:23 | 30K |
| Montevideo, Uruguay_ 2005 MMM.htm | 23-Mar-2006 20:09 | 34K |
| Montreal, Quebec, Canada. MMM 2003.htm | 11-Nov-2007 15:39 | 31K |
| Moscow, Russia. Global Marijuana March. May 5, 2007. Page 1.htm | 25-Oct-2008 09:19 | 42K |
| Moscow, Russia. Global Marijuana March. May 5, 2007. Page 2.htm | 25-Oct-2008 09:21 | 37K |
| Moscow, Russia. Global Marijuana March. May 5, 2007. Page 3.htm | 25-Oct-2008 09:22 | 37K |
| Moscow, Russia. Global Marijuana March. May 5, 2007. Page 4.htm | 25-Oct-2008 09:22 | 37K |
| Moscow, Russia. Global Marijuana March. May 5, 2007. Page 5.htm | 25-Oct-2008 09:23 | 37K |
| Moscow, Russia. Global Marijuana March. May 5, 2007. Page 6.htm | 25-Oct-2008 09:24 | 37K |
| Moscow, Russia. Global Marijuana March. May 5, 2007. Page 7.htm | 25-Oct-2008 09:24 | 37K |
| Moscow, Russia. Global Marijuana March. May 5, 2007. Page 8.htm | 25-Oct-2008 09:25 | 37K |
| Moscow, Russia. Global Marijuana March. May 5, 2007. Page 9.htm | 25-Oct-2008 09:26 | 27K |
| Moscow, Russia. Million Marijuana March. May 4, 2004.htm | 28-Apr-2008 19:56 | 64K |
| Nazi-like brutality of U_S_ criminal justice system and pris.htm | 15-Apr-2008 22:12 | 51K |
| Nevada, USA_ Marijuana initiative_ November 7, 2006.htm | 19-Jan-2008 16:24 | 20K |
| New York City, USA. 2007 GMM-MMM. Posters, flyers, banners.htm | 03-May-2007 15:10 | 28K |
| New York City, USA_ GMM-MMM 2006.htm | 11-Nov-2007 15:35 | 47K |
| Niagara_Falls_2005_April_16/ | 12-Oct-2008 05:13 | - |
| Nimbin, New South Wales, Australia_ GMM-MMM_ Mardi Grass 2006.htm | 14-May-2006 21:58 | 43K |
| November Coalition charts.htm | 22-Nov-2007 01:06 | 61K |
| Paris, France. 2007 GMM-MMM. Posters, flyers, banners.htm | 25-Oct-2008 10:04 | 12K |
| Paris, France. Global Marijuana March. May 5, 2007. Page 1.htm | 25-Oct-2008 10:03 | 34K |
| Paris, France. Global Marijuana March. May 5, 2007.htm | 26-Apr-2008 09:30 | 60K |
| Potsdam, Germany. 2004 MMM.htm | 11-Nov-2007 15:40 | 60K |
| Poznan, Poland. June 21, 2004. Cannabis Picnic.htm | 11-Nov-2007 15:41 | 63K |
| Prague, Czech Republic_ GMM-MMM 2006.htm | 14-May-2006 22:00 | 53K |
| ProjectPEACE/ | 12-Oct-2008 05:14 | - |
| Raleigh, North Carolina, USA. 2007 GMM-MMM. Posters, flyers, banners.htm | 01-Apr-2007 19:46 | 35K |
| Renee Boje. American medical cannabis refugee in Canada. Page 1.htm | 26-Oct-2008 08:09 | 37K |
| Renee Boje. American medical cannabis refugee in Canada. Page 3.htm | 26-Oct-2008 08:20 | 15K |
| Renee Boje_ American medical cannabis refugee in Canada.htm | 15-Sep-2006 03:57 | 62K |
| Rio de Janeiro, Brazil. 2002 MMM. Million Marijuana March..htm | 11-Jul-2007 10:48 | 37K |
| Rio de Janeiro, Brazil. 2005 GMM-MMM. Global Marijuana March.htm | 11-Jul-2007 11:01 | 61K |
| Rio de Janeiro, Brazil. 2006 GMM-MMM. Global Marijuana March.htm | 11-Jul-2007 10:59 | 30K |
| Rio de Janeiro, Brazil. MMM 2004 photos and video..htm | 13-Jan-2007 08:34 | 29K |
| Rome, Italy. MMM-GMM 2006.htm | 14-Aug-2007 21:39 | 66K |
| Rome, Italy. MMM 2006 png flyers.htm | 01-Apr-2008 18:55 | 23K |
| Rosario, Argentina_ MMM 2002.htm | 19-Jan-2008 16:19 | 22K |
| Rostock, Germany. 2004 Hanffest. September 4.htm | 11-Nov-2007 15:58 | 67K |
| San Francisco, California, USA. September 10, 2005..htm | 30-Dec-2006 16:23 | 55K |
| Santiago, Chile. May 15, 2005. GMM-MMM.htm | 11-Apr-2007 14:29 | 30K |
| Sao Paulo, Brazil. GMM-MMM 2006.htm | 11-Nov-2007 15:36 | 21K |
| Seattle, Washington, USA. 2000 MMM..htm | 19-Jan-2008 16:06 | 69K |
| Sofia, Bulgaria_ GMM-MMM 2006.htm | 14-May-2006 22:03 | 20K |
| St. Petersburg, Russia. Global Marijuana March 2006.htm | 11-Feb-2008 18:59 | 47K |
| Stockholm, Sweden_ GMM-MMM 2006.htm | 14-May-2006 22:04 | 23K |
| Strange/ | 12-Oct-2008 05:15 | - |
| TaZeRs-Pics/ | 12-Oct-2008 05:15 | - |
| Temporary folder. Not event related.htm | 01-Apr-2008 17:42 | 60K |
| Toronto, Ontario, Canada. 2005 MMM.htm | 11-Nov-2007 15:54 | 63K |
| Toronto, Ontario, Canada. GMM-MMM 2006.htm | 06-Mar-2007 15:57 | 68K |
| Tromso, Norway. GMM-MMM 2006.htm | 11-Nov-2007 15:38 | 21K |
| Tucson, Arizona, USA_ GMM-MMM 2006.htm | 14-May-2006 22:09 | 43K |
| Upload images for cannabis events and campaigns.htm | 01-Apr-2008 18:20 | 76K |
| Vancouver, British Columbia, Canada_ Sept_ 10, 2005.htm | 05-Jan-2006 16:53 | 68K |
| Vancouver rally to free Schapelle Corby_ Oct_ 18, 2005.htm | 21-May-2006 13:45 | 65K |
| Washington, DC, USA_ GMM-MMM 2006.htm | 14-May-2006 22:11 | 16K |
| akha/ | 08-Apr-2009 11:23 | - |
| album01/ | 24-Oct-2008 21:49 | - |
| album05/ | 24-Oct-2008 21:49 | - |
| album08/ | 24-Oct-2008 21:49 | - |
| album11/ | 24-Oct-2008 21:49 | - |
| album12/ | 28-Oct-2008 18:33 | - |
| album56/ | 24-Oct-2008 21:49 | - |
| album61/ | 24-Oct-2008 21:49 | - |
| albums-page2.htm | 02-Dec-2008 04:12 | 55K |
| albums.htm | 02-Dec-2008 04:09 | 62K |
| albums/ | 31-May-2009 06:12 | - |
| alva2006mmm/ | 24-Oct-2008 21:49 | - |
| amsterdam2004june5/ | 24-Oct-2008 21:49 | - |
| amsterdam2004mmm/ | 24-Oct-2008 21:49 | - |
| amsterdam2005june4/ | 24-Oct-2008 21:49 | - |
| amsterdam2005may7/ | 24-Oct-2008 21:49 | - |
| animations/ | 24-Oct-2008 21:49 | - |
| antwerp2007mmm-graphics/ | 24-Oct-2008 21:49 | - |
| arcata2006mmm/ | 24-Oct-2008 21:49 | - |
| athabasca2004mmm/ | 24-Oct-2008 21:49 | - |
| athens2005mmm/ | 24-Oct-2008 21:49 | - |
| auburn2006jan31/ | 21-Mar-2009 10:08 | - |
| auckland1999mmm/ | 24-Oct-2008 21:49 | - |
| auckland2000mmm/ | 24-Oct-2008 21:49 | - |
| auckland2001mmm/ | 01-Dec-2008 09:46 | - |
| auckland2002mmm/ | 24-Oct-2008 21:49 | - |
| auckland2006mmm/ | 24-Oct-2008 21:49 | - |
| australia/ | 24-Oct-2008 21:49 | - |
| bannerstats/ | 24-Oct-2008 21:49 | - |
| belgrade2005mmm/ | 24-Oct-2008 21:49 | - |
| berlin2000mmm/ | 24-Oct-2008 21:49 | - |
| berlin2002mmm/ | 24-Oct-2008 21:49 | - |
| berlin2003mmm/ | 24-Oct-2008 21:49 | - |
| berlin2005sep14to16/ | 24-Oct-2008 21:49 | - |
| berlin2007mmm-graphics/ | 24-Oct-2008 21:49 | - |
| berlin2009mmm/ | 17-May-2009 23:27 | - |
| bern2003mmm/ | 24-Oct-2008 21:49 | - |
| boise2005mmm/ | 24-Oct-2008 21:49 | - |
| boulder2005mmm/ | 24-Oct-2008 21:49 | - |
| boulder2006april20/ | 24-Oct-2008 21:50 | - |
| boulder2006mmm/ | 12-Oct-2008 05:09 | - |
| boulder2007mmm/ | 12-Oct-2008 05:09 | - |
| boulder2008mmm/ | 26-Apr-2009 05:26 | - |
| bremen2002mmm/ | 12-Oct-2008 05:10 | - |
| budapest2003mmm/ | 12-Oct-2008 05:10 | - |
| budapest2004mmm/ | 12-Oct-2008 05:10 | - |
| budapest2005mmm/ | 12-Oct-2008 05:10 | - |
| budapest2006mmm/ | 12-Oct-2008 05:10 | - |
| buenosaires2005mmm/ | 12-Oct-2008 05:10 | - |
| calgary2005sept24/ | 12-Oct-2008 05:10 | - |
| calgary2006mmm/ | 12-Oct-2008 05:10 | - |
| canada2007poll/ | 12-Oct-2008 05:10 | - |
| cannabis/ | 12-Oct-2008 05:10 | - |
| cannabisprofessionals/ | 28-Oct-2008 18:34 | - |
| capetown2002mmm/ | 12-Oct-2008 05:10 | - |
| capetown2003mmm/ | 12-Oct-2008 05:10 | - |
| capetown2004mmm/ | 12-Oct-2008 05:10 | - |
| capetown2005mmm/ | 12-Oct-2008 05:10 | - |
| charts/ | 12-Oct-2008 05:10 | - |
| charts_album_page1.htm | 23-Oct-2008 11:34 | 54K |
| charts_album_page2.htm | 23-Oct-2008 11:34 | 15K |
| chicago2002mmm/ | 12-Oct-2008 05:10 | - |
| chicago2005sept10/ | 12-Oct-2008 05:10 | - |
| chile2007mmm-graphics/ | 12-Oct-2008 05:10 | - |
| christchurch2002mmm/ | 12-Oct-2008 05:10 | - |
| christchurch2003mmm/ | 12-Oct-2008 05:10 | - |
| christchurch2004mmm/ | 12-Oct-2008 05:10 | - |
| christchurch2005mmm/ | 12-Oct-2008 05:10 | - |
| copenhagen2005mmm/ | 12-Oct-2008 05:10 | - |
| cplcannabis/ | 28-Oct-2008 19:36 | - |
| cryote/ | 12-Oct-2008 05:11 | - |
| css/ | 26-Oct-2008 19:43 | - |
| dallas2006mmm/ | 12-Oct-2008 05:11 | - |
| darmstadt2004mmm/ | 12-Oct-2008 05:11 | - |
| darwin2006mmm/ | 12-Oct-2008 05:11 | - |
| denver2005nov1/ | 21-Mar-2009 10:36 | - |
| desmoines2006mmm/ | 12-Oct-2008 05:11 | - |
| dlee/ | 12-Oct-2008 05:11 | - |
| edmonton2006overgrow/ | 12-Oct-2008 05:11 | - |
| eugene2006mmm/ | 12-Oct-2008 05:11 | - |
| finland2007mmm-graphics/ | 12-Oct-2008 05:11 | - |
| frankfurt2004mmm/ | 12-Oct-2008 05:11 | - |
| frankfurt2009mmm/ | 21-May-2009 21:29 | - |
| graphics/ | 12-Oct-2008 05:11 | - |
| halifax2005sept10/ | 12-Oct-2008 05:11 | - |
| hamilton2005august20/ | 28-Oct-2008 19:42 | - |
| hamilton2006april20/ | 12-Oct-2008 05:11 | - |
| hartford2006mmm/ | 12-Oct-2008 05:11 | - |
| hempfest2005/ | 12-Oct-2008 05:11 | - |
| images/ | 26-Oct-2008 19:43 | - |
| iowacity2006mmm/ | 12-Oct-2008 05:11 | - |
| japan2007mmm-graphics/ | 28-Oct-2008 19:42 | - |
| jerusalem2006mmm/ | 12-Oct-2008 05:11 | - |
| jerusalem2007mmm/ | 12-Oct-2008 05:11 | - |
| jodie/ | 12-Oct-2008 05:11 | - |
| kiev2005mmm/ | 28-Oct-2008 19:47 | - |
| kiev2006mmm/ | 12-Oct-2008 05:11 | - |
| kiev2007mmm-graphics/ | 12-Oct-2008 05:11 | - |
| krisg/ | 12-Oct-2008 05:11 | - |
| lasvegas2007mmm/ | 12-Oct-2008 05:11 | - |
| leipzig2001mmm/ | 12-Oct-2008 05:11 | - |
| leipzig2002mmm/ | 12-Oct-2008 05:11 | - |
| leipzig2003mmm/ | 12-Oct-2008 05:11 | - |
| leipzig2004mmm/ | 12-Oct-2008 05:12 | - |
| leipzig2005mmm/ | 12-Oct-2008 05:12 | - |
| lisbon2007mmm-graphics/ | 12-Oct-2008 05:12 | - |
| ljubljana2005mmm/ | 12-Oct-2008 05:12 | - |
| london15may2005mmm/ | 12-Oct-2008 05:12 | - |
| london2005sept10/ | 12-Oct-2008 05:12 | - |
| losangeles2002mmm/ | 12-Oct-2008 05:12 | - |
| madrid2004may8/ | 12-Oct-2008 05:12 | - |
| madrid2005mmm/ | 12-Oct-2008 05:12 | - |
| malaga2006mmm/ | 12-Oct-2008 05:12 | - |
| manleyhotsprings2006mmm/ | 12-Oct-2008 05:12 | - |
| manleyhotsprings2007mmm/ | 12-Oct-2008 05:12 | - |
| marc-emery/ | 12-Oct-2008 05:12 | - |
| marihemp1/ | 12-Oct-2008 05:12 | - |
| marijuana/ | 23-Mar-2009 08:33 | - |
| med-mj/ | 12-Oct-2008 05:12 | - |
| mexicocity2002mmm/ | 12-Oct-2008 05:12 | - |
| mexicocity2003mmm/ | 12-Oct-2008 05:12 | - |
| mexicocity2004mmm/ | 28-Nov-2008 08:05 | - |
| mexicocity2005mmm/ | 12-Oct-2008 05:12 | - |
| mexicocity2006mmm/ | 12-Oct-2008 05:12 | - |
| missoula2005mmm/ | 12-Oct-2008 05:12 | - |
| mj-arrests/ | 12-Oct-2008 05:12 | - |
| mmm/ | 02-Dec-2008 04:26 | - |
| mmm1999/ | 15-Mar-2009 06:16 | - |
| mmm1999flyers/ | 12-Oct-2008 05:12 | - |
| mmm2000/ | 15-Mar-2009 06:13 | - |
| mmm2000flyers/ | 31-May-2009 05:05 | - |
| mmm2001/ | 15-Mar-2009 06:18 | - |
| mmm2001flyers/ | 12-Oct-2008 05:12 | - |
| mmm2002/ | 15-Mar-2009 06:01 | - |
| mmm2002flyers/ | 12-Oct-2008 05:12 | - |
| mmm2003/ | 15-Mar-2009 06:20 | - |
| mmm2003flyers/ | 12-Oct-2008 05:12 | - |
| mmm2004/ | 15-Mar-2009 06:22 | - |
| mmm2004flyers/ | 28-Oct-2008 19:53 | - |
| mmm2005/ | 15-Mar-2009 06:28 | - |
| mmm2005flyers/ | 21-Mar-2009 10:01 | - |
| mmmbannersflyers/ | 28-Oct-2008 20:08 | - |
| montevideo2005mmm/ | 12-Oct-2008 05:12 | - |
| montevideo2007mmm-graphics/ | 12-Oct-2008 05:12 | - |
| montevideo2007mmm/ | 12-Oct-2008 05:12 | - |
| montreal2003mmm/ | 12-Oct-2008 05:12 | - |
| montreal2005mmm/ | 12-Oct-2008 05:12 | - |
| montreal2005sept10/ | 12-Oct-2008 05:12 | - |
| moscow2004mmm/ | 12-Oct-2008 05:12 | - |
| moscow2006mmm/ | 12-Mar-2009 21:29 | - |
| moscow2007mmm-graphics/ | 15-Mar-2009 08:12 | - |
| moscow2007mmm-park/ | 12-Oct-2008 05:13 | - |
| moscow2007mmm/ | 12-Oct-2008 05:13 | - |
| nagaoka2005mmm/ | 12-Oct-2008 05:13 | - |
![[IMG]](/icons/image2.gif) | nav_home.gif | 04-Apr-2008 00:50 | 74 |
| nevada2006nov7/ | 12-Oct-2008 05:13 | - |
| newyorkcity2006mmm/ | 12-Oct-2008 05:13 | - |
| newyorkcity2007mmm-graphics/ | 12-Oct-2008 05:13 | - |
| nimbin2006mmm-mardigrass/ | 12-Oct-2008 05:13 | - |
| november/ | 28-Oct-2008 20:10 | - |
| otheruploads/ | 12-Oct-2008 05:13 | - |
| ottawa2004FillTheHill/ | 12-Oct-2008 05:13 | - |
| paris2002mmm/ | 12-Oct-2008 05:13 | - |
| paris2003mmm/ | 12-Oct-2008 05:13 | - |
| paris2006mmm/ | 12-Oct-2008 05:13 | - |
| paris2007mmm-graphics/ | 12-Oct-2008 05:13 | - |
| paris2007mmm/ | 12-Oct-2008 05:13 | - |
| peoria2005mmm/ | 12-Oct-2008 05:13 | - |
| peoria2007mmm-graphics/ | 12-Oct-2008 05:13 | - |
| phoenix2005mmm/ | 12-Oct-2008 05:14 | - |
| polls/ | 12-Oct-2008 05:14 | - |
| portland2004mmm/ | 12-Oct-2008 05:14 | - |
| portland2005mmm/ | 12-Oct-2008 05:14 | - |
| porto-alegre2005mmm/ | 12-Oct-2008 05:14 | - |
| porto2007mmm-graphics/ | 12-Oct-2008 05:14 | - |
| potsdam2004mmm/ | 12-Oct-2008 05:14 | - |
| poznan2004june21/ | 12-Oct-2008 05:14 | - |
| prague2004mmm/ | 12-Oct-2008 05:14 | - |
| prague2006mmm/ | 12-Oct-2008 05:14 | - |
| prague2007mmm-graphics/ | 12-Oct-2008 05:14 | - |
| prisons.htm | 23-Oct-2008 11:34 | 34K |
| prisons/ | 12-Oct-2008 05:14 | - |
| prophet-yahweh/ | 12-Oct-2008 05:14 | - |
| public_domain_free/ | 12-Oct-2008 05:14 | - |
| raleigh2007mmm-graphics/ | 28-Oct-2008 20:13 | - |
| regina2005sept10/ | 12-Oct-2008 05:14 | - |
| renee-boje/ | 12-Oct-2008 05:14 | - |
| revisions/ | 12-Oct-2008 05:14 | - |
| rio_de_janeiro2004mmm/ | 12-Oct-2008 05:14 | - |
| riodejaneiro2002mmm/ | 12-Oct-2008 05:14 | - |
| riodejaneiro2005mmm/ | 12-Oct-2008 05:14 | - |
| riodejaneiro2006mmm/ | 12-Oct-2008 05:14 | - |
| rome2005mmm/ | 12-Oct-2008 05:14 | - |
| rome2006flyers/ | 28-Mar-2009 20:25 | - |
| rome2006mmm/ | 12-Oct-2008 05:14 | - |
| ron_bennett/ | 12-Oct-2008 05:14 | - |
| rosario2002mmm/ | 12-Oct-2008 05:14 | - |
| rostock2004hanffest/ | 12-Oct-2008 05:14 | - |
| rostock2005mmm/ | 12-Oct-2008 05:14 | - |
| sacramento2005april9medmj/ | 12-Oct-2008 05:14 | - |
| sacramento2005mmm/ | 12-Oct-2008 05:14 | - |
| salvador2007mmm-graphics/ | 12-Oct-2008 05:14 | - |
| sanfrancisco2005sept10/ | 30-Mar-2009 00:42 | - |
| sanfrancisco2005sept16/ | 28-Oct-2008 20:26 | - |
| santiago2005may15/ | 12-Oct-2008 05:14 | - |
| saopaulo2006mmm/ | 12-Oct-2008 05:14 | - |
| saskatoon2005mmm/ | 12-Oct-2008 05:14 | - |
| seattle2000mmm/ | 28-Oct-2008 20:27 | - |
| seattle2005august20/ | 12-Oct-2008 05:14 | - |
| sofia2005mmm/ | 12-Oct-2008 05:14 | - |
| sofia2006mmm/ | 12-Oct-2008 05:14 | - |
| spain2007mmm-graphics/ | 12-Oct-2008 05:14 | - |
| st_petersburg2006mmm/ | 12-Oct-2008 05:15 | - |
| stlouis2005mmm/ | 12-Oct-2008 05:14 | - |
| stockholm2004mmm/ | 12-Oct-2008 05:15 | - |
| stockholm2006mmm/ | 12-Oct-2008 05:15 | - |
| sulphursprings2005mmm/ | 12-Oct-2008 05:15 | - |
| tel-aviv2005mmm/ | 12-Oct-2008 05:15 | - |
| tel_aviv2004mmm/ | 12-Oct-2008 05:15 | - |
| telford2007mmm/ | 12-Oct-2008 05:15 | - |
| tokyo2008mmm/ | 08-Nov-2008 03:28 | - |
| toronto2003mmm/ | 12-Oct-2008 05:15 | - |
| toronto2004mmm/ | 12-Oct-2008 05:15 | - |
| toronto2005sept10/ | 12-Oct-2008 05:15 | - |
| toronto2006mmm/ | 28-Oct-2008 21:05 | - |
| toronto2007mmm-graphics/ | 28-Oct-2008 21:05 | - |
| toronto2009mmm/ | 31-May-2009 06:16 | - |
| toronto_2005mmm/ | 12-Oct-2008 05:15 | - |
| tromso2006mmm/ | 28-Oct-2008 21:05 | - |
| tucson2005sept13/ | 28-Oct-2008 21:06 | - |
| tucson2006mmm/ | 28-Oct-2008 21:07 | - |
| upload/ | 28-Oct-2008 21:07 | - |
| uploadmmm/ | 28-Oct-2008 21:09 | - |
| vancouver420in2004/ | 28-Oct-2008 22:15 | - |
| vancouver420in2005/ | 28-Oct-2008 22:16 | - |
| vancouver2001mmm/ | 28-Oct-2008 21:11 | - |
| vancouver2004mmm/ | 28-Oct-2008 21:11 | - |
| vancouver2005cannabisday/ | 28-Oct-2008 21:17 | - |
| vancouver2005mmm/ | 28-Oct-2008 21:20 | - |
| vancouver2005nov10/ | 28-Oct-2008 21:30 | - |
| vancouver2005oct18/ | 28-Oct-2008 22:05 | - |
| vancouver2005sep3/ | 28-Oct-2008 22:13 | - |
| vancouver2005sept10/ | 28-Oct-2008 22:15 | - |
| vienna2009gmm/ | 17-May-2009 23:21 | - |
| vitoria-gasteiz2006mmm/ | 28-Oct-2008 22:18 | - |
| warsaw2004mmm/ | 28-Oct-2008 22:19 | - |
| warsaw2005mmm/ | 28-Oct-2008 22:19 | - |
| warsaw2007mmm-graphics/ | 28-Oct-2008 22:22 | - |
| washington_dc2006mmm/ | 28-Oct-2008 22:22 | - |
| wellington2005sept10/ | 28-Oct-2008 22:23 | - |
| wo-reason/ | 28-Oct-2008 23:06 | - |
| xalapa2005june/ | 28-Oct-2008 23:08 | - |
| years/ | 23-Mar-2009 19:46 | - |
| z/ | 28-Oct-2008 23:08 | - |
|
|---|
